C16H12F6N2O2 — CID 139246694
1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(hydroxymethyl)phenyl]urea (PubChem CID 139246694) has the molecular formula C16H12F6N2O2 and a molecular weight of 378.27 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(hydroxymethyl)phenyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(hydroxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 139246694 |
| Molecular Formula | C16H12F6N2O2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(hydroxymethyl)phenyl]urea |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1ccccc1CO |
| InChI | InChI=1S/C16H12F6N2O2/c17-15(18,19)10-5-11(16(20,21)22)7-12(6-10)23-14(26)24-13-4-2-1-3-9(13)8-25/h1-7,25H,8H2,(H2,23,24,26) |
| InChIKey | OANARORNMDUXQF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |