C20H15F3N2O — CID 2421688
1-(2-phenylphenyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 2421688) has the molecular formula C20H15F3N2O and a molecular weight of 356.35 g/mol. Its IUPAC name is 1-(2-phenylphenyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-phenylphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 2421688 |
| Molecular Formula | C20H15F3N2O |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-(2-phenylphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H15F3N2O/c21-20(22,23)15-9-6-10-16(13-15)24-19(26)25-18-12-5-4-11-17(18)14-7-2-1-3-8-14/h1-13H,(H2,24,25,26) |
| InChIKey | FGFJRLSAMPYWTP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |