C20H15F3N2O2 — CID 22011313
1-[2-hydroxy-4-(trifluoromethyl)phenyl]-3-(2-phenylphenyl)urea (PubChem CID 22011313) has the molecular formula C20H15F3N2O2 and a molecular weight of 372.35 g/mol. Its IUPAC name is 1-[2-hydroxy-4-(trifluoromethyl)phenyl]-3-(2-phenylphenyl)urea.
| Compound Name | 1-[2-hydroxy-4-(trifluoromethyl)phenyl]-3-(2-phenylphenyl)urea |
|---|---|
| PubChem CID | 22011313 |
| Molecular Formula | C20H15F3N2O2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-[2-hydroxy-4-(trifluoromethyl)phenyl]-3-(2-phenylphenyl)urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H15F3N2O2/c21-20(22,23)14-10-11-17(18(26)12-14)25-19(27)24-16-9-5-4-8-15(16)13-6-2-1-3-7-13/h1-12,26H,(H2,24,25,27) |
| InChIKey | SWIRMXTXRCDCJK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|