C22H16F3NO4 — CID 23130330
2-[3-hydroxy-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetic acid (PubChem CID 23130330) has the molecular formula C22H16F3NO4 and a molecular weight of 415.37 g/mol. Its IUPAC name is 2-[3-hydroxy-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[3-hydroxy-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 23130330 |
| Molecular Formula | C22H16F3NO4 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[3-hydroxy-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c(O)c1 |
| InChI | InChI=1S/C22H16F3NO4/c23-22(24,25)15-8-6-14(7-9-15)16-3-1-2-4-17(16)21(30)26-18-10-5-13(11-19(18)27)12-20(28)29/h1-11,27H,12H2,(H,26,30)(H,28,29) |
| InChIKey | OECMJZUBXUXEPM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|