C34H27F3N2O8 — CID 150510670
2-[[2-[3-acetamido-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioic acid (PubChem CID 150510670) has the molecular formula C34H27F3N2O8 and a molecular weight of 648.59 g/mol. Its IUPAC name is 2-[[2-[3-acetamido-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioic acid.
| Compound Name | 2-[[2-[3-acetamido-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioic acid |
|---|---|
| PubChem CID | 150510670 |
| Molecular Formula | C34H27F3N2O8 |
| Molecular Weight | 648.59 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | 2-[[2-[3-acetamido-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioic acid |
| SMILES | CC(=O)Nc1cc(CC(=O)OCC(C(=O)O)(C(=O)O)c2ccccc2)ccc1NC(=O)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C34H27F3N2O8/c1-20(40)38-28-17-21(18-29(41)47-19-33(31(43)44,32(45)46)23-7-3-2-4-8-23)11-16-27(28)39-30(42)26-10-6-5-9-25(26)22-12-14-24(15-13-22)34(35,36)37/h2-17H,18-19H2,1H3,(H,38,40)(H,39,42)(H,43,44)(H,45,46) |
| InChIKey | HZTJEFXZFGQANJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|