C50H53F3N2O11 — CID 157104931
diethyl 2-[[2-[3-ethoxy-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioate;ethyl 2-(4-amino-3-ethoxyphenyl)acetate (PubChem CID 157104931) has the molecular formula C50H53F3N2O11 and a molecular weight of 914.97 g/mol. Its IUPAC name is diethyl 2-[[2-[3-ethoxy-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioate;ethyl 2-(4-amino-3-ethoxyphenyl)acetate.
| Compound Name | diethyl 2-[[2-[3-ethoxy-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioate;ethyl 2-(4-amino-3-ethoxyphenyl)acetate |
|---|---|
| PubChem CID | 157104931 |
| Molecular Formula | C50H53F3N2O11 |
| Molecular Weight | 914.97 g/mol |
| Exact Mass | 914.36 |
| IUPAC Name | diethyl 2-[[2-[3-ethoxy-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioate;ethyl 2-(4-amino-3-ethoxyphenyl)acetate |
| SMILES | CCOC(=O)C(COC(=O)Cc1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c(OCC)c1)(C(=O)OCC)c1ccccc1.CCOC(=O)Cc1ccc(N)c(OCC)c1 |
| InChI | InChI=1S/C38H36F3NO8.C12H17NO3/c1-4-47-32-22-25(23-33(43)50-24-37(35(45)48-5-2,36(46)49-6-3)27-12-8-7-9-13-27)16-21-31(32)42-34(44)30-15-11-10-14-29(30)26-17-19-28(20-18-26)38(39,40)41;1-3-15-11-7-9(5-6-10(11)13)8-12(14)16-4-2/h7-22H,4-6,23-24H2,1-3H3,(H,42,44);5-7H,3-4,8,13H2,1-2H3 |
| InChIKey | AGEPYMZLBWWVHD-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.97 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|