C40H38F3NO9 — CID 11204904
diethyl 2-[[2-[4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-3-propanoyloxyphenyl]acetyl]oxymethyl]-2-phenylpropanedioate (PubChem CID 11204904) has the molecular formula C40H38F3NO9 and a molecular weight of 733.74 g/mol. Its IUPAC name is diethyl 2-[[2-[4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-3-propanoyloxyphenyl]acetyl]oxymethyl]-2-phenylpropanedioate.
| Compound Name | diethyl 2-[[2-[4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-3-propanoyloxyphenyl]acetyl]oxymethyl]-2-phenylpropanedioate |
|---|---|
| PubChem CID | 11204904 |
| Molecular Formula | C40H38F3NO9 |
| Molecular Weight | 733.74 g/mol |
| Exact Mass | 733.25 |
| IUPAC Name | diethyl 2-[[2-[4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-3-propanoyloxyphenyl]acetyl]oxymethyl]-2-phenylpropanedioate |
| SMILES | CCOC(=O)C(COC(=O)Cc1ccc(NC(=O)c2ccc(C)cc2-c2ccc(C(F)(F)F)cc2)c(OC(=O)CC)c1)(C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C40H38F3NO9/c1-5-34(45)53-33-22-26(23-35(46)52-24-39(37(48)50-6-2,38(49)51-7-3)28-11-9-8-10-12-28)14-20-32(33)44-36(47)30-19-13-25(4)21-31(30)27-15-17-29(18-16-27)40(41,42)43/h8-22H,5-7,23-24H2,1-4H3,(H,44,47) |
| InChIKey | KLWKZXKEKXLENJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.74 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|