C41H39F3N2O7 — CID 174527063
diethyl 2-[2-oxo-3-[4-[[2-phenyl-5-(trifluoromethyl)benzoyl]amino]-3-(pyrrolidine-1-carbonyl)phenyl]propyl]-2-phenylpropanedioate (PubChem CID 174527063) has the molecular formula C41H39F3N2O7 and a molecular weight of 728.76 g/mol. Its IUPAC name is diethyl 2-[2-oxo-3-[4-[[2-phenyl-5-(trifluoromethyl)benzoyl]amino]-3-(pyrrolidine-1-carbonyl)phenyl]propyl]-2-phenylpropanedioate.
| Compound Name | diethyl 2-[2-oxo-3-[4-[[2-phenyl-5-(trifluoromethyl)benzoyl]amino]-3-(pyrrolidine-1-carbonyl)phenyl]propyl]-2-phenylpropanedioate |
|---|---|
| PubChem CID | 174527063 |
| Molecular Formula | C41H39F3N2O7 |
| Molecular Weight | 728.76 g/mol |
| Exact Mass | 728.27 |
| IUPAC Name | diethyl 2-[2-oxo-3-[4-[[2-phenyl-5-(trifluoromethyl)benzoyl]amino]-3-(pyrrolidine-1-carbonyl)phenyl]propyl]-2-phenylpropanedioate |
| SMILES | CCOC(=O)C(CC(=O)Cc1ccc(NC(=O)c2cc(C(F)(F)F)ccc2-c2ccccc2)c(C(=O)N2CCCC2)c1)(C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C41H39F3N2O7/c1-3-52-38(50)40(39(51)53-4-2,29-15-9-6-10-16-29)26-31(47)23-27-17-20-35(34(24-27)37(49)46-21-11-12-22-46)45-36(48)33-25-30(41(42,43)44)18-19-32(33)28-13-7-5-8-14-28/h5-10,13-20,24-25H,3-4,11-12,21-23,26H2,1-2H3,(H,45,48) |
| InChIKey | YMBSNWFUWXQNKR-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.76 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|