C28H25F3N2O3 — CID 142276825
N-[4-(2-oxoethyl)-2-(piperidine-1-carbonyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 142276825) has the molecular formula C28H25F3N2O3 and a molecular weight of 494.51 g/mol. Its IUPAC name is N-[4-(2-oxoethyl)-2-(piperidine-1-carbonyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-(2-oxoethyl)-2-(piperidine-1-carbonyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 142276825 |
| Molecular Formula | C28H25F3N2O3 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-[4-(2-oxoethyl)-2-(piperidine-1-carbonyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=CCc1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C28H25F3N2O3/c29-28(30,31)21-11-9-20(10-12-21)22-6-2-3-7-23(22)26(35)32-25-13-8-19(14-17-34)18-24(25)27(36)33-15-4-1-5-16-33/h2-3,6-13,17-18H,1,4-5,14-16H2,(H,32,35) |
| InChIKey | YCRJNLDEEPXGPI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|