C35H29F3N2O9 — CID 152595957
2-[[2-[3-(methoxymethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioic acid (PubChem CID 152595957) has the molecular formula C35H29F3N2O9 and a molecular weight of 678.62 g/mol. Its IUPAC name is 2-[[2-[3-(methoxymethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioic acid.
| Compound Name | 2-[[2-[3-(methoxymethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioic acid |
|---|---|
| PubChem CID | 152595957 |
| Molecular Formula | C35H29F3N2O9 |
| Molecular Weight | 678.62 g/mol |
| Exact Mass | 678.18 |
| IUPAC Name | 2-[[2-[3-(methoxymethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioic acid |
| SMILES | COCNC(=O)c1cc(CC(=O)OCC(C(=O)O)(C(=O)O)c2ccccc2)ccc1NC(=O)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H29F3N2O9/c1-48-20-39-30(42)27-17-21(18-29(41)49-19-34(32(44)45,33(46)47)23-7-3-2-4-8-23)11-16-28(27)40-31(43)26-10-6-5-9-25(26)22-12-14-24(15-13-22)35(36,37)38/h2-17H,18-20H2,1H3,(H,39,42)(H,40,43)(H,44,45)(H,46,47) |
| InChIKey | YWMFDHYGMRQIIL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|