C39H36BrF3N2O8 — CID 11657875
diethyl 2-[[2-[3-bromo-5-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioate (PubChem CID 11657875) has the molecular formula C39H36BrF3N2O8 and a molecular weight of 797.62 g/mol. Its IUPAC name is diethyl 2-[[2-[3-bromo-5-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioate.
| Compound Name | diethyl 2-[[2-[3-bromo-5-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioate |
|---|---|
| PubChem CID | 11657875 |
| Molecular Formula | C39H36BrF3N2O8 |
| Molecular Weight | 797.62 g/mol |
| Exact Mass | 796.16 |
| IUPAC Name | diethyl 2-[[2-[3-bromo-5-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetyl]oxymethyl]-2-phenylpropanedioate |
| SMILES | CCOC(=O)C(COC(=O)Cc1cc(Br)c(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c(C(=O)N(C)C)c1)(C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C39H36BrF3N2O8/c1-5-51-36(49)38(37(50)52-6-2,26-12-8-7-9-13-26)23-53-32(46)22-24-20-30(35(48)45(3)4)33(31(40)21-24)44-34(47)29-15-11-10-14-28(29)25-16-18-27(19-17-25)39(41,42)43/h7-21H,5-6,22-23H2,1-4H3,(H,44,47) |
| InChIKey | VLJMVLJVRQYUNA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.62 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|