C27H18F3N3O4 — CID 135254500
N'-(4-nitro-2-phenylphenyl)-N-[2-phenyl-4-(trifluoromethyl)phenyl]oxamide (PubChem CID 135254500) has the molecular formula C27H18F3N3O4 and a molecular weight of 505.45 g/mol. Its IUPAC name is N'-(4-nitro-2-phenylphenyl)-N-[2-phenyl-4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-(4-nitro-2-phenylphenyl)-N-[2-phenyl-4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 135254500 |
| Molecular Formula | C27H18F3N3O4 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | N'-(4-nitro-2-phenylphenyl)-N-[2-phenyl-4-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1-c1ccccc1)C(=O)Nc1ccc(C(F)(F)F)cc1-c1ccccc1 |
| InChI | InChI=1S/C27H18F3N3O4/c28-27(29,30)19-11-13-23(21(15-19)17-7-3-1-4-8-17)31-25(34)26(35)32-24-14-12-20(33(36)37)16-22(24)18-9-5-2-6-10-18/h1-16H,(H,31,34)(H,32,35) |
| InChIKey | CIHFHGXZRMPORL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|