C16H11F6NO — CID 162534936
N-[4-(trifluoromethyl)-2-[3-(trifluoromethyl)phenyl]phenyl]acetamide (PubChem CID 162534936) has the molecular formula C16H11F6NO and a molecular weight of 347.26 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)-2-[3-(trifluoromethyl)phenyl]phenyl]acetamide.
| Compound Name | N-[4-(trifluoromethyl)-2-[3-(trifluoromethyl)phenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 162534936 |
| Molecular Formula | C16H11F6NO |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[4-(trifluoromethyl)-2-[3-(trifluoromethyl)phenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(F)(F)F)cc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F6NO/c1-9(24)23-14-6-5-12(16(20,21)22)8-13(14)10-3-2-4-11(7-10)15(17,18)19/h2-8H,1H3,(H,23,24) |
| InChIKey | YMJHPURYPLPSKS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |