C19H20F3NO — CID 67742586
3-methyl-N-[4-methyl-2-[3-(trifluoromethyl)phenyl]phenyl]butanamide (PubChem CID 67742586) has the molecular formula C19H20F3NO and a molecular weight of 335.37 g/mol. Its IUPAC name is 3-methyl-N-[4-methyl-2-[3-(trifluoromethyl)phenyl]phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-methyl-2-[3-(trifluoromethyl)phenyl]phenyl]butanamide |
|---|---|
| PubChem CID | 67742586 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-methyl-N-[4-methyl-2-[3-(trifluoromethyl)phenyl]phenyl]butanamide |
| SMILES | Cc1ccc(NC(=O)CC(C)C)c(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H20F3NO/c1-12(2)9-18(24)23-17-8-7-13(3)10-16(17)14-5-4-6-15(11-14)19(20,21)22/h4-8,10-12H,9H2,1-3H3,(H,23,24) |
| InChIKey | HYBJIDDZVSOYHB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |