C21H20F3NO — CID 166063893
N-[2-(3,3-dimethyl-2-phenylcyclobuten-1-yl)-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 166063893) has the molecular formula C21H20F3NO and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[2-(3,3-dimethyl-2-phenylcyclobuten-1-yl)-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-(3,3-dimethyl-2-phenylcyclobuten-1-yl)-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 166063893 |
| Molecular Formula | C21H20F3NO |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[2-(3,3-dimethyl-2-phenylcyclobuten-1-yl)-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(F)(F)F)cc1C1=C(c2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C21H20F3NO/c1-13(26)25-18-10-9-15(21(22,23)24)11-16(18)17-12-20(2,3)19(17)14-7-5-4-6-8-14/h4-11H,12H2,1-3H3,(H,25,26) |
| InChIKey | WCZSCEGJSUUJJU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|