C20H20ClNO — CID 166063904
N-[2-[2-(3-chlorophenyl)-3,3-dimethylcyclobuten-1-yl]phenyl]acetamide (PubChem CID 166063904) has the molecular formula C20H20ClNO and a molecular weight of 325.84 g/mol. Its IUPAC name is N-[2-[2-(3-chlorophenyl)-3,3-dimethylcyclobuten-1-yl]phenyl]acetamide.
| Compound Name | N-[2-[2-(3-chlorophenyl)-3,3-dimethylcyclobuten-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 166063904 |
| Molecular Formula | C20H20ClNO |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[2-[2-(3-chlorophenyl)-3,3-dimethylcyclobuten-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1C1=C(c2cccc(Cl)c2)C(C)(C)C1 |
| InChI | InChI=1S/C20H20ClNO/c1-13(23)22-18-10-5-4-9-16(18)17-12-20(2,3)19(17)14-7-6-8-15(21)11-14/h4-11H,12H2,1-3H3,(H,22,23) |
| InChIKey | GMHZWQLOVAXHEV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|