C19H17ClN2O — CID 91533678
N-[2-(3-chlorophenyl)phenyl]-1,4-dimethylpyrrole-3-carboxamide (PubChem CID 91533678) has the molecular formula C19H17ClN2O and a molecular weight of 324.81 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)phenyl]-1,4-dimethylpyrrole-3-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)phenyl]-1,4-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 91533678 |
| Molecular Formula | C19H17ClN2O |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[2-(3-chlorophenyl)phenyl]-1,4-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cn(C)cc1C(=O)Nc1ccccc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O/c1-13-11-22(2)12-17(13)19(23)21-18-9-4-3-8-16(18)14-6-5-7-15(20)10-14/h3-12H,1-2H3,(H,21,23) |
| InChIKey | SOPCEZWGEPXKLM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |