C20H14ClF5N2O — CID 91453109
N-(5-chloro-2-phenylphenyl)-1-methyl-4-(1,1,2,2,2-pentafluoroethyl)pyrrole-3-carboxamide (PubChem CID 91453109) has the molecular formula C20H14ClF5N2O and a molecular weight of 428.79 g/mol. Its IUPAC name is N-(5-chloro-2-phenylphenyl)-1-methyl-4-(1,1,2,2,2-pentafluoroethyl)pyrrole-3-carboxamide.
| Compound Name | N-(5-chloro-2-phenylphenyl)-1-methyl-4-(1,1,2,2,2-pentafluoroethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 91453109 |
| Molecular Formula | C20H14ClF5N2O |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | N-(5-chloro-2-phenylphenyl)-1-methyl-4-(1,1,2,2,2-pentafluoroethyl)pyrrole-3-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2cc(Cl)ccc2-c2ccccc2)c(C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H14ClF5N2O/c1-28-10-15(16(11-28)19(22,23)20(24,25)26)18(29)27-17-9-13(21)7-8-14(17)12-5-3-2-4-6-12/h2-11H,1H3,(H,27,29) |
| InChIKey | LDWYSUNYUSBRFW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|