C18H12ClF4N3O — CID 68915098
N-[2-(5-chloro-2-fluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 68915098) has the molecular formula C18H12ClF4N3O and a molecular weight of 397.76 g/mol. Its IUPAC name is N-[2-(5-chloro-2-fluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-(5-chloro-2-fluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 68915098 |
| Molecular Formula | C18H12ClF4N3O |
| Molecular Weight | 397.76 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | N-[2-(5-chloro-2-fluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccccc2-c2cc(Cl)ccc2F)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H12ClF4N3O/c1-26-9-13(16(25-26)18(21,22)23)17(27)24-15-5-3-2-4-11(15)12-8-10(19)6-7-14(12)20/h2-9H,1H3,(H,24,27) |
| InChIKey | UCZBXWWBPAOWRL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.76 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |