C18H12Cl4FN3O — CID 67374092
3-[dichloro(fluoro)methyl]-N-[2-(3,4-dichlorophenyl)phenyl]-1-methylpyrazole-4-carboxamide (PubChem CID 67374092) has the molecular formula C18H12Cl4FN3O and a molecular weight of 447.12 g/mol. Its IUPAC name is 3-[dichloro(fluoro)methyl]-N-[2-(3,4-dichlorophenyl)phenyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 3-[dichloro(fluoro)methyl]-N-[2-(3,4-dichlorophenyl)phenyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 67374092 |
| Molecular Formula | C18H12Cl4FN3O |
| Molecular Weight | 447.12 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | 3-[dichloro(fluoro)methyl]-N-[2-(3,4-dichlorophenyl)phenyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccccc2-c2ccc(Cl)c(Cl)c2)c(C(F)(Cl)Cl)n1 |
| InChI | InChI=1S/C18H12Cl4FN3O/c1-26-9-12(16(25-26)18(21,22)23)17(27)24-15-5-3-2-4-11(15)10-6-7-13(19)14(20)8-10/h2-9H,1H3,(H,24,27) |
| InChIKey | NFOOLPDAMOWFFS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.12 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|