C18H14Cl2FN3O — CID 123339665
N-(2,3-dichloro-4-fluoro-6-phenylphenyl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 123339665) has the molecular formula C18H14Cl2FN3O and a molecular weight of 378.23 g/mol. Its IUPAC name is N-(2,3-dichloro-4-fluoro-6-phenylphenyl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(2,3-dichloro-4-fluoro-6-phenylphenyl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123339665 |
| Molecular Formula | C18H14Cl2FN3O |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-(2,3-dichloro-4-fluoro-6-phenylphenyl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)Nc1c(-c2ccccc2)cc(F)c(Cl)c1Cl |
| InChI | InChI=1S/C18H14Cl2FN3O/c1-10-13(9-24(2)23-10)18(25)22-17-12(11-6-4-3-5-7-11)8-14(21)15(19)16(17)20/h3-9H,1-2H3,(H,22,25) |
| InChIKey | HESPYLDBHTUTDC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|