C12H11Cl2N3O — CID 45285316
N-(2,4-dichlorophenyl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 45285316) has the molecular formula C12H11Cl2N3O and a molecular weight of 284.15 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 45285316 |
| Molecular Formula | C12H11Cl2N3O |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N3O/c1-7-9(6-17(2)16-7)12(18)15-11-4-3-8(13)5-10(11)14/h3-6H,1-2H3,(H,15,18) |
| InChIKey | ZTSSKEROGIEVPT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |