C13H11FN4O — CID 103820430
N-(4-cyano-2-fluorophenyl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 103820430) has the molecular formula C13H11FN4O and a molecular weight of 258.26 g/mol. Its IUPAC name is N-(4-cyano-2-fluorophenyl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(4-cyano-2-fluorophenyl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 103820430 |
| Molecular Formula | C13H11FN4O |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N-(4-cyano-2-fluorophenyl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)Nc1ccc(C#N)cc1F |
| InChI | InChI=1S/C13H11FN4O/c1-8-10(7-18(2)17-8)13(19)16-12-4-3-9(6-15)5-11(12)14/h3-5,7H,1-2H3,(H,16,19) |
| InChIKey | YGHPKBVIJRRQGU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |