C12H12FN3O — CID 45285304
N-(2-fluorophenyl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 45285304) has the molecular formula C12H12FN3O and a molecular weight of 233.25 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(2-fluorophenyl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 45285304 |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-(2-fluorophenyl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C12H12FN3O/c1-8-9(7-16(2)15-8)12(17)14-11-6-4-3-5-10(11)13/h3-7H,1-2H3,(H,14,17) |
| InChIKey | PTKWGZSVFVEUGH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |