C12H5Br2FN2OS — CID 103820442
2,5-dibromo-N-(4-cyano-2-fluorophenyl)thiophene-3-carboxamide (PubChem CID 103820442) has the molecular formula C12H5Br2FN2OS and a molecular weight of 404.06 g/mol. Its IUPAC name is 2,5-dibromo-N-(4-cyano-2-fluorophenyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(4-cyano-2-fluorophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103820442 |
| Molecular Formula | C12H5Br2FN2OS |
| Molecular Weight | 404.06 g/mol |
| Exact Mass | 401.85 |
| IUPAC Name | 2,5-dibromo-N-(4-cyano-2-fluorophenyl)thiophene-3-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(Br)sc2Br)c(F)c1 |
| InChI | InChI=1S/C12H5Br2FN2OS/c13-10-4-7(11(14)19-10)12(18)17-9-2-1-6(5-16)3-8(9)15/h1-4H,(H,17,18) |
| InChIKey | UPNLVTXNCLMIFO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.06 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |