C11H7Br2FN2O3S2 — CID 107965284
2,5-dibromo-N-(2-fluoro-4-sulfamoylphenyl)thiophene-3-carboxamide (PubChem CID 107965284) has the molecular formula C11H7Br2FN2O3S2 and a molecular weight of 458.13 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-fluoro-4-sulfamoylphenyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(2-fluoro-4-sulfamoylphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107965284 |
| Molecular Formula | C11H7Br2FN2O3S2 |
| Molecular Weight | 458.13 g/mol |
| Exact Mass | 455.82 |
| IUPAC Name | 2,5-dibromo-N-(2-fluoro-4-sulfamoylphenyl)thiophene-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cc(Br)sc2Br)c(F)c1 |
| InChI | InChI=1S/C11H7Br2FN2O3S2/c12-9-4-6(10(13)20-9)11(17)16-8-2-1-5(3-7(8)14)21(15,18)19/h1-4H,(H,16,17)(H2,15,18,19) |
| InChIKey | HXXQOSGPIUNKMD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.13 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |