C11H7BrCl2N2O3S2 — CID 107965275
N-(2-bromo-4-sulfamoylphenyl)-2,5-dichlorothiophene-3-carboxamide (PubChem CID 107965275) has the molecular formula C11H7BrCl2N2O3S2 and a molecular weight of 430.13 g/mol. Its IUPAC name is N-(2-bromo-4-sulfamoylphenyl)-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-(2-bromo-4-sulfamoylphenyl)-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107965275 |
| Molecular Formula | C11H7BrCl2N2O3S2 |
| Molecular Weight | 430.13 g/mol |
| Exact Mass | 427.85 |
| IUPAC Name | N-(2-bromo-4-sulfamoylphenyl)-2,5-dichlorothiophene-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cc(Cl)sc2Cl)c(Br)c1 |
| InChI | InChI=1S/C11H7BrCl2N2O3S2/c12-7-3-5(21(15,18)19)1-2-8(7)16-11(17)6-4-9(13)20-10(6)14/h1-4H,(H,16,17)(H2,15,18,19) |
| InChIKey | FDJMPFBVHCAACY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.13 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |