C13H13BrN2O3S2 — CID 65238411
N-(2-bromo-4-sulfamoylphenyl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 65238411) has the molecular formula C13H13BrN2O3S2 and a molecular weight of 389.30 g/mol. Its IUPAC name is N-(2-bromo-4-sulfamoylphenyl)-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(2-bromo-4-sulfamoylphenyl)-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 65238411 |
| Molecular Formula | C13H13BrN2O3S2 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | N-(2-bromo-4-sulfamoylphenyl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(S(N)(=O)=O)cc2Br)sc1C |
| InChI | InChI=1S/C13H13BrN2O3S2/c1-7-5-12(20-8(7)2)13(17)16-11-4-3-9(6-10(11)14)21(15,18)19/h3-6H,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | YVPJMSMEHHCYQD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |