C11H8Br2N2O4S — CID 61128224
5-bromo-N-(2-bromo-4-sulfamoylphenyl)furan-2-carboxamide (PubChem CID 61128224) has the molecular formula C11H8Br2N2O4S and a molecular weight of 424.07 g/mol. Its IUPAC name is 5-bromo-N-(2-bromo-4-sulfamoylphenyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(2-bromo-4-sulfamoylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 61128224 |
| Molecular Formula | C11H8Br2N2O4S |
| Molecular Weight | 424.07 g/mol |
| Exact Mass | 421.86 |
| IUPAC Name | 5-bromo-N-(2-bromo-4-sulfamoylphenyl)furan-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccc(Br)o2)c(Br)c1 |
| InChI | InChI=1S/C11H8Br2N2O4S/c12-7-5-6(20(14,17)18)1-2-8(7)15-11(16)9-3-4-10(13)19-9/h1-5H,(H,15,16)(H2,14,17,18) |
| InChIKey | CVNMVPIYXMNLNX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.07 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |