C12H11BrN2O4S — CID 47175858
5-bromo-N-[3-(methylsulfamoyl)phenyl]furan-2-carboxamide (PubChem CID 47175858) has the molecular formula C12H11BrN2O4S and a molecular weight of 359.20 g/mol. Its IUPAC name is 5-bromo-N-[3-(methylsulfamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-(methylsulfamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 47175858 |
| Molecular Formula | C12H11BrN2O4S |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 5-bromo-N-[3-(methylsulfamoyl)phenyl]furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cccc(NC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C12H11BrN2O4S/c1-14-20(17,18)9-4-2-3-8(7-9)15-12(16)10-5-6-11(13)19-10/h2-7,14H,1H3,(H,15,16) |
| InChIKey | ZUJGEZWTOCZKEA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |