C18H12BrF3N2O4S — CID 39154493
5-bromo-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]furan-2-carboxamide (PubChem CID 39154493) has the molecular formula C18H12BrF3N2O4S and a molecular weight of 489.27 g/mol. Its IUPAC name is 5-bromo-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39154493 |
| Molecular Formula | C18H12BrF3N2O4S |
| Molecular Weight | 489.27 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 5-bromo-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C18H12BrF3N2O4S/c19-16-8-7-15(28-16)17(25)23-12-4-2-6-14(10-12)29(26,27)24-13-5-1-3-11(9-13)18(20,21)22/h1-10,24H,(H,23,25) |
| InChIKey | WOGSTSAPWJQJOB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.27 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |