C21H16F3N3O5S — CID 31245458
3-methyl-2-nitro-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]benzamide (PubChem CID 31245458) has the molecular formula C21H16F3N3O5S and a molecular weight of 479.44 g/mol. Its IUPAC name is 3-methyl-2-nitro-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]benzamide.
| Compound Name | 3-methyl-2-nitro-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 31245458 |
| Molecular Formula | C21H16F3N3O5S |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 3-methyl-2-nitro-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2cccc(S(=O)(=O)Nc3cccc(C(F)(F)F)c3)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16F3N3O5S/c1-13-5-2-10-18(19(13)27(29)30)20(28)25-15-7-4-9-17(12-15)33(31,32)26-16-8-3-6-14(11-16)21(22,23)24/h2-12,26H,1H3,(H,25,28) |
| InChIKey | XMAJPSHQFBKAGA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|