C13H8BrF3N2O3 — CID 108933256
5-bromo-N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]furan-2-carboxamide (PubChem CID 108933256) has the molecular formula C13H8BrF3N2O3 and a molecular weight of 377.12 g/mol. Its IUPAC name is 5-bromo-N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 108933256 |
| Molecular Formula | C13H8BrF3N2O3 |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 5-bromo-N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)C(F)(F)F)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H8BrF3N2O3/c14-10-5-4-9(22-10)11(20)18-7-2-1-3-8(6-7)19-12(21)13(15,16)17/h1-6H,(H,18,20)(H,19,21) |
| InChIKey | WSZWGCDXAQWWPY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |