C13H9BrN2O2 — CID 59654859
5-bromo-N-[3-(cyanomethyl)phenyl]furan-2-carboxamide (PubChem CID 59654859) has the molecular formula C13H9BrN2O2 and a molecular weight of 305.13 g/mol. Its IUPAC name is 5-bromo-N-[3-(cyanomethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-(cyanomethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 59654859 |
| Molecular Formula | C13H9BrN2O2 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 5-bromo-N-[3-(cyanomethyl)phenyl]furan-2-carboxamide |
| SMILES | N#CCc1cccc(NC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C13H9BrN2O2/c14-12-5-4-11(18-12)13(17)16-10-3-1-2-9(8-10)6-7-15/h1-5,8H,6H2,(H,16,17) |
| InChIKey | RGENWXYICFVQAJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |