C12H9BrN2O2S — CID 24691295
5-bromo-N-(3-carbamothioylphenyl)furan-2-carboxamide (PubChem CID 24691295) has the molecular formula C12H9BrN2O2S and a molecular weight of 325.19 g/mol. Its IUPAC name is 5-bromo-N-(3-carbamothioylphenyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(3-carbamothioylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 24691295 |
| Molecular Formula | C12H9BrN2O2S |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 5-bromo-N-(3-carbamothioylphenyl)furan-2-carboxamide |
| SMILES | NC(=S)c1cccc(NC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C12H9BrN2O2S/c13-10-5-4-9(17-10)12(16)15-8-3-1-2-7(6-8)11(14)18/h1-6H,(H2,14,18)(H,15,16) |
| InChIKey | XNQVZSRGLFYHKE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|