C18H13BrN4O4 — CID 55787295
5-bromo-N-[3-[(pyridine-3-carbonylamino)carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 55787295) has the molecular formula C18H13BrN4O4 and a molecular weight of 429.23 g/mol. Its IUPAC name is 5-bromo-N-[3-[(pyridine-3-carbonylamino)carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[(pyridine-3-carbonylamino)carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55787295 |
| Molecular Formula | C18H13BrN4O4 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 5-bromo-N-[3-[(pyridine-3-carbonylamino)carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(NNC(=O)c1cccc(NC(=O)c2ccc(Br)o2)c1)c1cccnc1 |
| InChI | InChI=1S/C18H13BrN4O4/c19-15-7-6-14(27-15)18(26)21-13-5-1-3-11(9-13)16(24)22-23-17(25)12-4-2-8-20-10-12/h1-10H,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | RUCDJTNYROHZQQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|