C23H20BrN3O4 — CID 55775222
5-bromo-N-[3-[[3-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 55775222) has the molecular formula C23H20BrN3O4 and a molecular weight of 482.33 g/mol. Its IUPAC name is 5-bromo-N-[3-[[3-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[[3-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55775222 |
| Molecular Formula | C23H20BrN3O4 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 5-bromo-N-[3-[[3-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCCC2)c1)c1cccc(NC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C23H20BrN3O4/c24-20-10-9-19(31-20)22(29)26-17-7-3-5-15(13-17)21(28)25-18-8-4-6-16(14-18)23(30)27-11-1-2-12-27/h3-10,13-14H,1-2,11-12H2,(H,25,28)(H,26,29) |
| InChIKey | ITAOJKDMWWZUEF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |