C24H23BrN2O4 — CID 55774560
5-bromo-N-[3-[4-[hydroxy(phenyl)methyl]piperidine-1-carbonyl]phenyl]furan-2-carboxamide (PubChem CID 55774560) has the molecular formula C24H23BrN2O4 and a molecular weight of 483.36 g/mol. Its IUPAC name is 5-bromo-N-[3-[4-[hydroxy(phenyl)methyl]piperidine-1-carbonyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[4-[hydroxy(phenyl)methyl]piperidine-1-carbonyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55774560 |
| Molecular Formula | C24H23BrN2O4 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 5-bromo-N-[3-[4-[hydroxy(phenyl)methyl]piperidine-1-carbonyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCC(C(O)c3ccccc3)CC2)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C24H23BrN2O4/c25-21-10-9-20(31-21)23(29)26-19-8-4-7-18(15-19)24(30)27-13-11-17(12-14-27)22(28)16-5-2-1-3-6-16/h1-10,15,17,22,28H,11-14H2,(H,26,29) |
| InChIKey | KZLYFZFMVOYFEA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |