C16H15BrN2O3S — CID 55868816
5-bromo-N-[3-(thiomorpholine-4-carbonyl)phenyl]furan-2-carboxamide (PubChem CID 55868816) has the molecular formula C16H15BrN2O3S and a molecular weight of 395.28 g/mol. Its IUPAC name is 5-bromo-N-[3-(thiomorpholine-4-carbonyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-(thiomorpholine-4-carbonyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55868816 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 5-bromo-N-[3-(thiomorpholine-4-carbonyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCSCC2)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C16H15BrN2O3S/c17-14-5-4-13(22-14)15(20)18-12-3-1-2-11(10-12)16(21)19-6-8-23-9-7-19/h1-5,10H,6-9H2,(H,18,20) |
| InChIKey | GGTRDWIEOVVMQV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |