C20H17BrN2O5 — CID 46488415
5-bromo-N-[3-[(3,4-dimethoxyphenyl)carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 46488415) has the molecular formula C20H17BrN2O5 and a molecular weight of 445.27 g/mol. Its IUPAC name is 5-bromo-N-[3-[(3,4-dimethoxyphenyl)carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[(3,4-dimethoxyphenyl)carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46488415 |
| Molecular Formula | C20H17BrN2O5 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 5-bromo-N-[3-[(3,4-dimethoxyphenyl)carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccc(NC(=O)c3ccc(Br)o3)c2)cc1OC |
| InChI | InChI=1S/C20H17BrN2O5/c1-26-15-7-6-14(11-17(15)27-2)22-19(24)12-4-3-5-13(10-12)23-20(25)16-8-9-18(21)28-16/h3-11H,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | KRDGKNKXXMVCJV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |