C14H13BrN2O5 — CID 2355027
5-bromo-N'-(3,4-dimethoxybenzoyl)furan-2-carbohydrazide (PubChem CID 2355027) has the molecular formula C14H13BrN2O5 and a molecular weight of 369.17 g/mol. Its IUPAC name is 5-bromo-N'-(3,4-dimethoxybenzoyl)furan-2-carbohydrazide.
| Compound Name | 5-bromo-N'-(3,4-dimethoxybenzoyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 2355027 |
| Molecular Formula | C14H13BrN2O5 |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 5-bromo-N'-(3,4-dimethoxybenzoyl)furan-2-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc(Br)o2)cc1OC |
| InChI | InChI=1S/C14H13BrN2O5/c1-20-9-4-3-8(7-11(9)21-2)13(18)16-17-14(19)10-5-6-12(15)22-10/h3-7H,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | YAZCSPFFRUPUDO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|