C20H27N3O7S — CID 38759705
N-tert-butyl-5-[[(3-methoxy-4-propan-2-yloxybenzoyl)amino]carbamoyl]furan-2-sulfonamide (PubChem CID 38759705) has the molecular formula C20H27N3O7S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-tert-butyl-5-[[(3-methoxy-4-propan-2-yloxybenzoyl)amino]carbamoyl]furan-2-sulfonamide.
| Compound Name | N-tert-butyl-5-[[(3-methoxy-4-propan-2-yloxybenzoyl)amino]carbamoyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 38759705 |
| Molecular Formula | C20H27N3O7S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-tert-butyl-5-[[(3-methoxy-4-propan-2-yloxybenzoyl)amino]carbamoyl]furan-2-sulfonamide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccc(S(=O)(=O)NC(C)(C)C)o2)ccc1OC(C)C |
| InChI | InChI=1S/C20H27N3O7S/c1-12(2)29-14-8-7-13(11-16(14)28-6)18(24)21-22-19(25)15-9-10-17(30-15)31(26,27)23-20(3,4)5/h7-12,23H,1-6H3,(H,21,24)(H,22,25) |
| InChIKey | VCQQCJQVIWFIFU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|