C18H21N3O6S — CID 55447326
4-[[(3-methoxy-4-propan-2-yloxybenzoyl)amino]sulfamoyl]benzamide (PubChem CID 55447326) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is 4-[[(3-methoxy-4-propan-2-yloxybenzoyl)amino]sulfamoyl]benzamide.
| Compound Name | 4-[[(3-methoxy-4-propan-2-yloxybenzoyl)amino]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55447326 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 4-[[(3-methoxy-4-propan-2-yloxybenzoyl)amino]sulfamoyl]benzamide |
| SMILES | COc1cc(C(=O)NNS(=O)(=O)c2ccc(C(N)=O)cc2)ccc1OC(C)C |
| InChI | InChI=1S/C18H21N3O6S/c1-11(2)27-15-9-6-13(10-16(15)26-3)18(23)20-21-28(24,25)14-7-4-12(5-8-14)17(19)22/h4-11,21H,1-3H3,(H2,19,22)(H,20,23) |
| InChIKey | HPMZENAJRMXTOY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|