C15H15ClN2O5S — CID 8616663
3-chloro-N'-(3,4-dimethoxyphenyl)sulfonylbenzohydrazide (PubChem CID 8616663) has the molecular formula C15H15ClN2O5S and a molecular weight of 370.81 g/mol. Its IUPAC name is 3-chloro-N'-(3,4-dimethoxyphenyl)sulfonylbenzohydrazide.
| Compound Name | 3-chloro-N'-(3,4-dimethoxyphenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 8616663 |
| Molecular Formula | C15H15ClN2O5S |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 3-chloro-N'-(3,4-dimethoxyphenyl)sulfonylbenzohydrazide |
| SMILES | COc1ccc(S(=O)(=O)NNC(=O)c2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C15H15ClN2O5S/c1-22-13-7-6-12(9-14(13)23-2)24(20,21)18-17-15(19)10-4-3-5-11(16)8-10/h3-9,18H,1-2H3,(H,17,19) |
| InChIKey | SNDOXUNRLFFAMF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|