C9H13N3O4S2 — CID 65214843
[(3,4-dimethoxyphenyl)sulfonylamino]thiourea (PubChem CID 65214843) has the molecular formula C9H13N3O4S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is [(3,4-dimethoxyphenyl)sulfonylamino]thiourea.
| Compound Name | [(3,4-dimethoxyphenyl)sulfonylamino]thiourea |
|---|---|
| PubChem CID | 65214843 |
| Molecular Formula | C9H13N3O4S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | [(3,4-dimethoxyphenyl)sulfonylamino]thiourea |
| SMILES | COc1ccc(S(=O)(=O)NNC(N)=S)cc1OC |
| InChI | InChI=1S/C9H13N3O4S2/c1-15-7-4-3-6(5-8(7)16-2)18(13,14)12-11-9(10)17/h3-5,12H,1-2H3,(H3,10,11,17) |
| InChIKey | GQKMVMYXAPECAD-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|