C10H15N3O3S2 — CID 65214109
[(4-ethoxy-3-methylphenyl)sulfonylamino]thiourea (PubChem CID 65214109) has the molecular formula C10H15N3O3S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is [(4-ethoxy-3-methylphenyl)sulfonylamino]thiourea.
| Compound Name | [(4-ethoxy-3-methylphenyl)sulfonylamino]thiourea |
|---|---|
| PubChem CID | 65214109 |
| Molecular Formula | C10H15N3O3S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | [(4-ethoxy-3-methylphenyl)sulfonylamino]thiourea |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(N)=S)cc1C |
| InChI | InChI=1S/C10H15N3O3S2/c1-3-16-9-5-4-8(6-7(9)2)18(14,15)13-12-10(11)17/h4-6,13H,3H2,1-2H3,(H3,11,12,17) |
| InChIKey | OQGCGYHECCBCPO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|