C17H21NO3S — CID 3265391
N-(3,5-dimethylphenyl)-4-ethoxy-3-methylbenzenesulfonamide (PubChem CID 3265391) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-ethoxy-3-methylbenzenesulfonamide.
| Compound Name | N-(3,5-dimethylphenyl)-4-ethoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3265391 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-ethoxy-3-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc(C)cc(C)c2)cc1C |
| InChI | InChI=1S/C17H21NO3S/c1-5-21-17-7-6-16(11-14(17)4)22(19,20)18-15-9-12(2)8-13(3)10-15/h6-11,18H,5H2,1-4H3 |
| InChIKey | UNXKZRSAEPFMLO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |