C15H15F2NO3S — CID 39825088
N-(2,6-difluorophenyl)-4-ethoxy-3-methylbenzenesulfonamide (PubChem CID 39825088) has the molecular formula C15H15F2NO3S and a molecular weight of 327.35 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-ethoxy-3-methylbenzenesulfonamide.
| Compound Name | N-(2,6-difluorophenyl)-4-ethoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 39825088 |
| Molecular Formula | C15H15F2NO3S |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-ethoxy-3-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2c(F)cccc2F)cc1C |
| InChI | InChI=1S/C15H15F2NO3S/c1-3-21-14-8-7-11(9-10(14)2)22(19,20)18-15-12(16)5-4-6-13(15)17/h4-9,18H,3H2,1-2H3 |
| InChIKey | ZLFAHMORSHLJJC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |