C17H22N2O6S2 — CID 9055901
3,4-diethoxy-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide (PubChem CID 9055901) has the molecular formula C17H22N2O6S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3,4-diethoxy-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide.
| Compound Name | 3,4-diethoxy-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 9055901 |
| Molecular Formula | C17H22N2O6S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3,4-diethoxy-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNS(=O)(=O)c2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C17H22N2O6S2/c1-4-24-16-11-10-15(12-17(16)25-5-2)27(22,23)19-18-26(20,21)14-8-6-13(3)7-9-14/h6-12,18-19H,4-5H2,1-3H3 |
| InChIKey | BKTQNOWYFFBUEN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|