C14H18N2O5S — CID 9067995
3,4-diethoxy-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 9067995) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 3,4-diethoxy-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 9067995 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3,4-diethoxy-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc(C)on2)cc1OCC |
| InChI | InChI=1S/C14H18N2O5S/c1-4-19-12-7-6-11(9-13(12)20-5-2)22(17,18)16-14-8-10(3)21-15-14/h6-9H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | WFOBDKQOUZMQJP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |